Daucosterol
Daucosterol
 |
| Names |
| Other names
Lyoniside, Daucosterol, Sitogluside, Eleutheroside A, Alexandrin, Coriandrinol, Daucosterin, beta-Sitosterol glucoside |
| Identifiers |
| 3D model (Jmol) |
Interactive image |
| ChEBI |
CHEBI:67554 |
| ChemSpider |
4674825 |
| PubChem |
5742590 |
InChI=1S/C35H60O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h10,20-22,24-33,36-39H,7-9,11-19H2,1-6H3/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1 Key: NPJICTMALKLTFW-OFUAXYCQSA-N InChI=1/C35H60O6/c1-7-22(20(2)3)9-8-21(4)26-12-13-27-25-11-10-23-18-24(14-16-34(23,5)28(25)15-17-35(26,27)6)40-33-32(39)31(38)30(37)29(19-36)41-33/h10,20-22,24-33,36-39H,7-9,11-19H2,1-6H3/t21-,22-,24+,25+,26-,27+,28+,29-,30-,31+,32-,33-,34+,35-/m1/s1 Key: NPJICTMALKLTFW-OFUAXYCQBI
|
CC[C@H](CC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)C)C)C(C)C
|
| Properties |
| |
C35H60O6 |
| Molar mass |
576.86 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
Daucosterol (eleutheroside A) is a natural phytosterol-like compound.[1] It is the glucoside of β-sitosterol.
References
- ↑ Xie, JX; Ji, Z (1981). "The chemical constituents of the Chinese drug "Yadanzi." I. Isolation and identification of daucosterol, brucein D and brucein E (author's transl)". Yao xue xue bao = Acta pharmaceutica Sinica. 16 (1): 53–5. PMID 7246155.