Kaempferol 3-O-rutinoside
Kaempferol 3-O-rutinoside
 |
| Names |
| IUPAC name
7-[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-3,
5-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
Other names
Kaempferol 3-O- rutinosideKaempferol 3-O-rhamnosyl-glucoside Nicotiflorine Kaempferol-3-O-β-D-glucopyranoside-7-O-α-L-rhamnopyranoside kaempferol 7-neohesperidoside |
| Identifiers |
| |
31921-42-3 17650-84-9 |
| 3D model (Jmol) |
Interactive image |
| ChEBI |
CHEBI:69657 |
| ChemSpider |
4477257 |
| EC Number |
241-377-3 |
| PubChem |
5318767 5483905 |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1 Key: RTATXGUCZHCSNG-QHWHWDPRSA-N InChI=1/C27H30O15/c1-9-17(31)20(34)22(36)26(39-9)38-8-15-18(32)21(35)23(37)27(41-15)42-25-19(33)16-13(30)6-12(29)7-14(16)40-24(25)10-2-4-11(28)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22+,23+,26+,27-/m0/s1 Key: RTATXGUCZHCSNG-QHWHWDPRBU
|
C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)Oc3c(=O)c4c(cc(cc4oc3c5ccc(cc5)O)O)O)O)O)O)O)O)O
|
| Properties |
| |
C27H30O15 |
| Molar mass |
594.52 g/mol |
| Density |
1.762 g/mL |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
| Infobox references |
|
|
Kaempferol-3-O-rutinoside is a bitter-tasting flavonol glycoside. It can be isolated from the rhizomes of the fern Selliguea feei.[1]
References
- ↑ Flavonoids and a proanthrocyanidin from rhizomes of Selliguea feei. Baek Nam-In, Kennelly E.J., Kardono L.B.S., Tsauri S., Padmawinata K., Soejarto D.D. and Kinghorn A.D., Phytochemistry, 1994, vol. 36, no2, pages 513-518, INIST:3300075
External links
Flavonols and their conjugates |
|---|
|
| Backbone | |
|---|
|
| Flavonols | Aglycones | |
|---|
| Conjugates | | |
|---|
| |
- Afzelin (Kaempferol 3-rhamnoside)
- Astragalin (kaempferol 3-O-glucoside)
- Kaempferitrin (kaempferol 3,7-dirhamnoside)
- Juglanin (Kaempferol 3-O-arabinoside)
- Kaempferol 3-alpha-L-arabinopyranoside
- Kaempferol 3-alpha-D-arabinopyranoside
- Kaempferol 7-alpha-L-arabinoside
- Kaempferol 7-O-glucoside
- Kaempferol 3-lathyroside
- Kaempferol 4'-rhamnoside
- Kaempferol 5-rhamnoside
- Kaempferol 7-rhamnoside
- Kaempferol 7-O-alpha-L-rhamnofuranoside
- Kaempferol 3-xyloside
- Kaempferol 7-xyloside
- Robinin (kaempferol-3-O-robinoside-7-O-rhamnoside)
- Kaempferol 3-O-rutinoside
- Sophoraflavonoloside (Kaempferol 3-O-sophoroside)
- Trifolin (Kaempferol 3-O-beta-D-galactoside)
|
|---|
| | |
|---|
| | |
|---|
|
|---|
|
|---|
|
| O-Methylated flavonols | Aglycones | |
|---|
| Glycosides | of isorhamnetin |
- Narcissin (Isorhamnetin 3-O-rutinoside)
- Isorhamnetin 3-O-glucoside
- Tamarixetin 7-rutinoside
|
|---|
| other |
- Azalein (Azaleatin 3-O-α-L-rhamnoside)
- Centaurein (Centaureidin 7-O-glucoside)
- Eupalin (Eupalitin 3-0-rhamnoside)
- Eupatolin (Eupatolitin 3-O-rhamnoside)
- Jacein (Jaceidin 7-O-glucoside)
- Patulitrin (Patuletin 7-O-glucoside
- Xanthorhamnin (Rhamnetin glycoside)
|
|---|
|
|---|
|
|---|
|
| Derivative flavonols | Aglycones |
- Noricaritin
- Dihydronoricaritin
|
|---|
| Glycosides | |
|---|
|
|---|
|
| Pyranoflavonols | |
|---|
|
| Furanoflavonols | |
|---|
|
| Semisynthetic | |
|---|