Viniferal
Viniferal
 |
| Names |
| IUPAC name
(2R,2′S,3R,3′S)-3′-(3,5-Dihydroxyphenyl)-6′-hydroxy-2,2′-bis(4-hydroxyphenyl)-2,2′,3,3′-tetrahydro-[3,4′-bibenzofuran]-5-carbaldehyde |
| Other names
(-)-Viniferal |
| Identifiers |
| |
180413-42-7 Y |
| 3D model (Jmol) |
Interactive image |
| ChemSpider |
26233612 Y |
InChI=1S/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 YKey: DHTHKPNODOWMKF-VPIGGYNKSA-N YInChI=1/C35H26O8/c36-17-18-1-10-29-27(11-18)32(35(42-29)20-4-8-23(38)9-5-20)28-15-26(41)16-30-33(28)31(21-12-24(39)14-25(40)13-21)34(43-30)19-2-6-22(37)7-3-19/h1-17,31-32,34-35,37-41H/t31-,32-,34+,35-/m0/s1 Key: DHTHKPNODOWMKF-VPIGGYNKBX
|
O=CC1=CC=C(O[C@@H](C2=CC=C(O)C=C2)[C@@H]3C4=CC(O)=CC5=C4[C@H](C6=CC(O)=CC(O)=C6)[C@@H](C7=CC=C(O)C=C7)O5)C3=C1
|
| Properties |
| |
C35H26O8 |
| Molar mass |
574.59 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
Y verify (what is Y N ?) |
| Infobox references |
|
|
Viniferal is a hydroxystilbenoid with an aldehyde group found in Vitis vinifera (grapevine).[1]
References
- ↑ Ito, J (1996). "Absolute structures of new hydroxystilbenoids, vitisin C and viniferal, from Vitis vinifera 'Kyohou'". Tetrahedron. 52 (30): 9991. doi:10.1016/0040-4020(96)00543-1.
External links
|
|---|
|
- Diptoindonesin C
- Diptoindonesin F
- Gnetin H
- Hemsleyanol D
- Isohopeaphenol
- Laetevirenol A, B, C, D and E
- Suffruticosol A and B
- Viniferal
- E-ω-viniferin
- Z-ω-viniferin
|
|
| Dimers |
- Diptoindonesin G
- Jezonodione
- B
- Scirpusin A
- Tibeticanol (piceatannol dimer)
|
|---|
|
| Trimers |
- Amurensin B
- Gnetin E
- Gneyulin A
- Johorenol A
- Ampelopsin E
- Vaticanol G
|
|---|
|
| Tetramers: |
- Dibalanocarpol
- Gnetin J (3"-hydroxygnetin E)
- Gnetin K (3"-methoxygnetin E)
- Gnetuhainin R (isorhapontigenin tetramer)
- Laetevirenol F and G
|
|---|
|
Higher polymers (five units or more) | |
|---|
|
Oligomeric forms of resveratrol | Dimers | |
|---|
| Trimers | |
|---|
| Tetramers | |
|---|
| Pentamers | |
|---|
| Hexamers | |
|---|
| Higher polymers |
- γ-viniferin
- Valeriaphenol A
|
|---|
|
|---|
|
| Glycosides or conjugates |
- Diptoindonesin A (C-glucoside of ε-viniferin)
- Foeniculoside I (glucoside of miyabenol C), II, III and IV
- Laevifonol (an ε-viniferin-ascorbic acid hybrid compound)
- Laevifoside (O-glucoside of ampelopsin A)
|
|---|