Enterodiol
Enterodiol
 |
| Names |
| IUPAC name
(2R,3R)-2,3-bis[(3-hydroxyphenyl)methyl]butane-1,4-diol |
| Other names
(−)-Enterodiol |
| Identifiers |
| |
80226-00-2 Y |
| 3D model (Jmol) |
Interactive image |
| ChEMBL |
ChEMBL471076 N |
| ChemSpider |
102992 N |
| ECHA InfoCard |
100.162.704 |
| PubChem |
115089 |
| UNII |
BZF4X2AWRP Y |
InChI=1S/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1 NKey: DWONJCNDULPHLV-HOTGVXAUSA-N NInChI=1/C18H22O4/c19-11-15(7-13-3-1-5-17(21)9-13)16(12-20)8-14-4-2-6-18(22)10-14/h1-6,9-10,15-16,19-22H,7-8,11-12H2/t15-,16-/m0/s1 Key: DWONJCNDULPHLV-HOTGVXAUBO
|
C1=CC(=CC(=C1)O)C[C@@H](CO)[C@@H](CC2=CC(=CC=C2)O)CO
|
| Properties |
| |
C18H22O4 |
| Molar mass |
302.37 g·mol−1 |
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa). |
N verify (what is Y N ?) |
| Infobox references |
|
|
Enterodiol is a lignan formed by the action of intestinal bacteria on lignan precursors found in plants.[1]
References
- ↑ Lampe JW (2003). "Isoflavonoid and lignan phytoestrogens as dietary biomarkers". J Nutr. 133 (Suppl 3): 956S–964S. PMID 12612182.
|
|---|
|
| Lignans | |
|---|
|
| Lignan glycosides | |
|---|
|
| Mammalian lignans (enterolignans) | |
|---|
|
| Neolignans | |
|---|
|
| Flavonolignans |
- Cinchonain-Ib
- Dehydrosilybin
- Deoxysilycistin
- Deoxysilydianin
- Hydnocarpin
- Hydnowightin
- Neosilyhermin
- Palstatin
- Rhodiolin
- Salcolin A
- Salcolin B
- Scutellaprostin A, B, C, D, E and F
- Silandrin
- Silyamandin
- Silibinin
- Silybinome
- Silicristin
- Silydianin
- Silyhermin
- Tricin 4'-O-(erythro-beta-guaiacylglyceryl) ether
- Tricin 4'-O-(threo-beta-guaiacylglyceryl) ether
|
|---|