Nabitan
Nabitan
 |
| Clinical data |
|---|
| ATC code |
none |
|---|
| Identifiers |
|---|
- (-)-8-(1,2-Dimethylheptyl)-1,3,4,5-tetrahydro-5,5-dimethyl-2-(2-propynyl) -2H-(1)benzopyrano(4,3-c)pyridin-10-yl 1-piperidinebutyrate
|
| CAS Number |
66556-74-9 Y |
|---|
| PubChem (CID) |
39503 |
|---|
| ChemSpider |
36117 Y |
|---|
| Chemical and physical data |
|---|
| Formula |
C35H52N2O3 |
|---|
| Molar mass |
548.799 g/mol |
|---|
| 3D model (Jmol) |
Interactive image |
|---|
O=C(Oc2cc(cc1OC(C\3=C(/c12)CN(CC/3)CC#C)(C)C)C(C)C(C)CCCCC)CCCN4CCCCC4
|
InChI=1S/C35H52N2O3/c1-7-9-11-15-26(3)27(4)28-23-31(39-33(38)16-14-21-36-19-12-10-13-20-36)34-29-25-37(18-8-2)22-17-30(29)35(5,6)40-32(34)24-28/h2,23-24,26-27H,7,9-22,25H2,1,3-6H3 YKey:MCVPMHDADNVRKF-UHFFFAOYSA-N Y
|
| (verify) |
|---|
Nabitan (Nabutam, Benzopyranoperidine, SP-106, Abbott 40656) is a synthetic cannabinoid analog of dronabinol (Marinol).[1] It exhibits antiemetic and analgesic effects, most likely by binding to and activating the CB1 and CB2 cannabinoid receptors, and reduced intraocular pressure in animal tests, making it potentially useful in the treatment of glaucoma.[2]
Nabitan has the advantage of being water-soluble, unlike most cannabinoid derivatives, and was researched for potential use as an analgesic or sedative,[3] although it was never developed for clinical use and is not currently used in medicine, as dronabinol or nabilone were felt to be more useful. However it is sometimes used in research into the potential therapeutic applications of cannabinoids.
References
- ↑ Razdan RK. The Total Synthesis of Cannabinoids. Wiley-Interscience 1980
- ↑ Razdan RK, Howes JF. "Drugs related to tetrahydrocannabinol." Medicinal Research Reviews 1983; 3(2):119-146. PMID 6134882
- ↑ Archer RA. "The cannabinoids: therapeutic potentials." Annual Reports in Medicinal Chemistry 1974; 9: 253-259. PMID 12307093
|
|---|
|
| Phytocannabinoids | |
|---|
|
| Endocannabinoids | |
|---|
|
Synthetic cannabinoids | Classical cannabinoids (dibenzopyrans) | |
|---|
| Non-classical cannabinoids | |
|---|
| | Benzoylindoles | |
|---|
| | Naphthoylindoles | |
|---|
| | Naphthoylindazoles | |
|---|
| | Pyrrolobenzoxazines | |
|---|
| | Naphthylmethylindoles | |
|---|
| | Phenylacetylindoles | |
|---|
| | Indole-3-carboxamides | |
|---|
| | Indole-3-carboxylates | |
|---|
| Tetramethylcyclo- propanoylindoles | |
|---|
| Indazole-3- carboxamides | |
|---|
| Tetramethylcyclo- propanoylindazoles | |
|---|
| | Naphthoylpyrroles | |
|---|
| | Eicosanoids | |
|---|
| | Pyrazolecarboxamides | |
|---|
| | Others | |
|---|
|
|---|
|
| Allosteric CBR ligands | |
|---|
|
Endocannabinoid enhancers (inactivation inhibitors) | |
|---|
|
Anticannabinoids (antagonists/inverse agonists/antibodies) | |
|---|
|
|
|
|---|
|
Psychedelics (5-HT2A agonists) | | |
|---|
| | | |
|---|
| HOT-* | |
|---|
| 25*-NB* (excludes FLY) | |
|---|
| Subst. mescaline | |
|---|
| | |
|---|
| 3C-* | |
|---|
| 4C-* | |
|---|
| FLY | |
|---|
| | |
|---|
| Others | |
|---|
|
|---|
| | |
|---|
| | | |
|---|
| |
- 4,5-DHP-DMT
- 2,N,N-TMT
- 4-AcO-DMT
- 4-HO-5-MeO-DMT
- 4,N,N-TMT
- 4-Propionyloxy-DMT
- 5,6-diBr-DMT
- 5-AcO-DMT
- 5-Bromo-DMT
- 5-MeO-2,N,N-TMT
- 5-MeO-4,N,N-TMT
- 5-MeO-α,N,N-TMT
- 5-MeO-DMT
- 5-N,N-TMT
- 7,N,N-TMT
- α,N,N-TMT
- (Bufotenin) 5-HO-DMT
- DMT
- Norbaeocystin
- (Psilocin) 4-HO-DMT
- (Psilocybin) 4-PO-DMT
|
|---|
| | |
|---|
| | |
|---|
| | |
|---|
| | |
|---|
| | |
|---|
| | |
|---|
| | |
|---|
| Others | |
|---|
|
|---|
| Others | |
|---|
|
|---|
|
Dissociatives (NMDAR antagonists) | |
|---|
|
Deliriants (mAChR antagonists) | |
|---|
|
| Others | |
|---|
|
|---|
|
Receptor (ligands) | |
- Antibodies: Brizantin (Бризантин)
- Dietressa (Диетресса)
|
|---|
| |
- Agonists: 2-AG
- 2-AGE (noladin ether)
- 3,3'-Diindolylmethane
- 4-O-Methylhonokiol
- α-Amyrin
- β-Amyrin
- A-796,260
- A-834,735
- A-836,339
- AM-1172
- AM-1221
- AM-1235
- AM-1241
- AM-2232
- Anandamide
- AZ-11713908
- Cannabinol
- Caryophyllene
- CB-13
- CBS-0550
- CP-55,940
- GW-405,833 (L-768,242)
- GW-842,166X
- HU-308
- JTE 7-31
- JWH-007
- JWH-015
- JWH-018
- JWH-73
- JWH-133
- L-759,633
- L-759,656
- Magnolol
- MDA-19
- Nabitan
- NADA
- PF-03550096
- S-444,823
- SER-601
- Serinolamide A
- UR-144
- Tedalinab
- THC (dronabinol)
- THCV
- Tetrahydromagnolol
- Virodhamine
|
|---|
| | |
|---|
| | |
|---|
| | |
|---|
|
|---|
|
Transporter (modulators) | |
|---|
|
Enzyme (modulators) | | |
|---|
| | |
|---|
| |
- Inhibitors: JZP-169
- JZP-430
- KT182
- KT185
- KT195
- KT203
- LEI-106
- ML294
- ML295
- ML296
- UCM710
- WWL-70
|
|---|
| | |
|---|
|
|---|
|
| Others |
- Others: 2-PG (directly potentiates activity of 2-AG at CB1 receptor)
- ARN-272 (FAAH-like anandamide transporter inhibitor)
|
|---|
|
- See also: Cannabinoids (cannabinoids by structure)
|