Azepindole
Azepindole|
|
| Clinical data |
|---|
| ATC code |
none |
|---|
| Identifiers |
|---|
- 2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole
|
| CAS Number |
26304-61-0 N |
|---|
| PubChem (CID) |
33471 |
|---|
| ChemSpider |
30893 Y |
|---|
| UNII |
6BB6FW9T8J Y |
|---|
| KEGG |
D03035 Y |
|---|
| ChEMBL |
CHEMBL10758 Y |
|---|
| Chemical and physical data |
|---|
| Formula |
C12H14N2 |
|---|
| Molar mass |
186.25 g/mol |
|---|
| 3D model (Jmol) |
Interactive image |
|---|
|
|
InChI=1S/C12H14N2/c1-2-5-12-10(4-1)8-11-9-13-6-3-7-14(11)12/h1-2,4-5,8,13H,3,6-7,9H2 YKey:FEJCIXJKPISCJV-UHFFFAOYSA-N Y
|
N Y (what is this?) (verify) |
|---|
Azepindole (McN-2453) is a tricyclic compound with antidepressant and antihypertensive effects that was developed in the late 1960s but was never marketed.[1]
See also
References
|
|---|
|
|
|
|
|
| |
|---|
| Non-selective | |
|---|
| MAOA-selective | |
|---|
| MAOB-Selective | |
|---|
|
|
|
|
|
|
|
|